Content deleted Content added
m →top: task, replaced: Phytomedicine : international journal of phytotherapy and phytopharmacology → Phytomedicine, added underlinked tag using AWB |
mNo edit summary |
||
(7 intermediate revisions by 5 users not shown) | |||
Line 1:
{{Chembox
<!-- Images -->
| ImageFile = Ganoderol A.svg
| ImageCaption1 = Ganoderol A
| ImageAlt =
<!-- Names -->
| IUPACName =
| OtherNames =
<!-- Sections -->
| Section1 = {{Chembox Identifiers
| CASNo = 104700-97-2
| ChemSpiderID = 10404029
| PubChem = 146156323
| InChI=1S/C30H46O2/c1-20(19-31)9-8-10-21(2)22-13-17-30(7)24-11-12-25-27(3,4)26(32)15-16-28(25,5)23(24)14-18-29(22,30)6/h9,11,14,21-22,25,31H,8,10,12-13,15-19H2,1-7H3/b20-9+
| InChIKey = QWFPQDGDUOGOJF-AWQFTUOYSA-N
| SMILES = CC(CC/C=C(\C)/CO)C1CCC2(C1(CC=C3C2=CCC4C3(CCC(=O)C4(C)C)C)C)C
}}
| Section2 = {{Chembox Properties
| Formula = C<sub>30</sub>H<sub>46</sub>O<sub>2</sub>
| MolarMass =
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
'''
▲'''Ganoderols''' are bio-active [[sterol]]s isolated from ''[[Ganoderma lucidum]]''.<ref>{{cite journal|pmid=21596546|year=2011|last1=Fatmawati|first1=S|last2=Shimizu|first2=K|last3=Kondo|first3=R|title=Ganoderol B: A potent α-glucosidase inhibitor isolated from the fruiting body of Ganoderma lucidum|volume=18|issue=12|pages=1053–5|doi=10.1016/j.phymed.2011.03.011|journal=Phytomedicine}}</ref><ref>{{cite journal|pmid=17499997|year=2007|last1=Liu|first1=J|last2=Shimizu|first2=K|last3=Konishi|first3=F|last4=Kumamoto|first4=S|last5=Kondo|first5=R|title=The anti-androgen effect of ganoderol B isolated from the fruiting body of Ganoderma lucidum|volume=15|issue=14|pages=4966–72|doi=10.1016/j.bmc.2007.04.036|journal=Bioorganic & Medicinal Chemistry}}</ref>
==References==
|