Ganoderol A: Difference between revisions

Revision as of 19:07, 20 July 2019

Latest revision as of 10:21, 25 September 2024

(5 intermediate revisions by 3 users not shown)

Line 1:

{{orphan|date=October 2013}}

{{Chembox

<!-- Images -->

| ImageFile = Ganoderol A.svg

| ImageFile1ImageCaption1 = Ganoderol B.svgA

| ImageCaption1 = Ganoderol A (top) and ganoderol B

| ImageAlt =

<!-- Names -->

Line 12 ⟶ 10:

| Section1 = {{Chembox Identifiers

| CASNo = 104700-97-2

| ChemSpiderID = 10404029

| CASNo_Comment = (A)

| CASNo1PubChem = 104700-96-1146156323

| InChI=1S/C30H46O2/c1-20(19-31)9-8-10-21(2)22-13-17-30(7)24-11-12-25-27(3,4)26(32)15-16-28(25,5)23(24)14-18-29(22,30)6/h9,11,14,21-22,25,31H,8,10,12-13,15-19H2,1-7H3/b20-9+

| CASNo1_Comment = (B)

| InChIKey = QWFPQDGDUOGOJF-AWQFTUOYSA-N

| PubChem =

| SMILES = CC(CC/C=C(\C)/CO)C1CCC2(C1(CC=C3C2=CCC4C3(CCC(=O)C4(C)C)C)C)C

| SMILES =

}}

| Section2 = {{Chembox Properties

| Formula = C₃₀H₄₆O₂ (A)<br>C₃₀H₄₈O₂ (B)

| MolarMass =

| Appearance =

Line 34 ⟶ 32:

}}

'''GanoderolsGanoderol A''' areis a [[triterpene]]s isolated from ''[[Ganoderma lucidum]]''.<ref>{{cite journal|pmid=21596546|year=2011|last1=Fatmawati|first1=S|last2=Shimizu|first2=K|last3=Kondo|first3=R|title=Ganoderol B: A potent α-glucosidase inhibitor isolated from the fruiting body of Ganoderma lucidum|volume=18|issue=12|pages=1053–5|doi=10.1016/j.phymed.2011.03.011|journal=Phytomedicine}}</ref><ref>{{cite journal|pmid=17499997|year=2007|last1=Liu|first1=J|last2=Shimizu|first2=K|last3=Konishi|first3=F|last4=Kumamoto|first4=S|last5=Kondo|first5=R|title=The anti-androgen effect of ganoderol B isolated from the fruiting body of Ganoderma lucidum|volume=15|issue=14|pages=4966–72|doi=10.1016/j.bmc.2007.04.036|journal=Bioorganic & Medicinal Chemistry}}</ref>

==References==