4-Cl-PHP: Difference between revisions

Revision as of 22:00, 24 August 2023

Latest revision as of 05:53, 28 July 2025

(3 intermediate revisions by 3 users not shown)

Line 9:

| IUPAC_name = 1-(4-chlorophenyl)-2-pyrrolidin-1-ylhexan-1-one

| CAS_number = 2748592-28-9

| ChemSpiderID = 129432275

| PubChem = 137331671  

| UNII = 4FEN4JLH4D

| smiles = CCCCC(C(=O)C1=CC=C(C=C1)Cl)N2CCCC2

| StdInChI = 1S/C16H22ClNO/c1-2-3-6-15(18-11-4-5-12-18)16(19)13-7-9-14(17)10-8-13/h7-10,15H,2-6,11-12H2,1H3

Line 27 ⟶ 28:

* [[MDPHP]]

* [[4F-PV9]]

* [[Chlorosipentramine]]

== References ==

Line 38 ⟶ 40:

[[Category:Designer drugs]]

[[Category:Serotonin-norepinephrine-dopamine releasing agents]]

[[Category:Chloroarenes4-Chlorophenyl compounds]]

{{nervous-system-drug-stub}}